C16H30N4O6 — CID 87388304
[(2S)-2-[[1-(carboxyamino)-4-[(3-methyl-1-oxobutan-2-yl)amino]butyl]amino]-3-methylbutanoyl]carbamic acid (PubChem CID 87388304) has the molecular formula C16H30N4O6 and a molecular weight of 374.44 g/mol. Its IUPAC name is [(2S)-2-[[1-(carboxyamino)-4-[(3-methyl-1-oxobutan-2-yl)amino]butyl]amino]-3-methylbutanoyl]carbamic acid.
| Compound Name | [(2S)-2-[[1-(carboxyamino)-4-[(3-methyl-1-oxobutan-2-yl)amino]butyl]amino]-3-methylbutanoyl]carbamic acid |
|---|---|
| PubChem CID | 87388304 |
| Molecular Formula | C16H30N4O6 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | [(2S)-2-[[1-(carboxyamino)-4-[(3-methyl-1-oxobutan-2-yl)amino]butyl]amino]-3-methylbutanoyl]carbamic acid |
| SMILES | CC(C)C(C=O)NCCCC(NC(=O)O)N[C@H](C(=O)NC(=O)O)C(C)C |
| InChI | InChI=1S/C16H30N4O6/c1-9(2)11(8-21)17-7-5-6-12(19-15(23)24)18-13(10(3)4)14(22)20-16(25)26/h8-13,17-19H,5-7H2,1-4H3,(H,20,22)(H,23,24)(H,25,26)/t11?,12?,13-/m0/s1 |
| InChIKey | WBVQGSXXEBTAHB-BPCQOVAHSA-N |
| XLogP | 0.58 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|