C12H22N4O6 — CID 87388623
[(2S)-2-[[1-(carboxyamino)-4-(1-oxopropan-2-ylamino)butyl]amino]propanoyl]carbamic acid (PubChem CID 87388623) has the molecular formula C12H22N4O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is [(2S)-2-[[1-(carboxyamino)-4-(1-oxopropan-2-ylamino)butyl]amino]propanoyl]carbamic acid.
| Compound Name | [(2S)-2-[[1-(carboxyamino)-4-(1-oxopropan-2-ylamino)butyl]amino]propanoyl]carbamic acid |
|---|---|
| PubChem CID | 87388623 |
| Molecular Formula | C12H22N4O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | [(2S)-2-[[1-(carboxyamino)-4-(1-oxopropan-2-ylamino)butyl]amino]propanoyl]carbamic acid |
| SMILES | CC(C=O)NCCCC(NC(=O)O)N[C@@H](C)C(=O)NC(=O)O |
| InChI | InChI=1S/C12H22N4O6/c1-7(6-17)13-5-3-4-9(15-11(19)20)14-8(2)10(18)16-12(21)22/h6-9,13-15H,3-5H2,1-2H3,(H,16,18)(H,19,20)(H,21,22)/t7?,8-,9?/m0/s1 |
| InChIKey | JHRPBSBGURQQKF-MGURRDGZSA-N |
| XLogP | -0.69 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|