C30H26F3N3O3 — CID 123876536
2-[2-methyl-4-[6-(phenylmethoxymethyl)pyrimidin-4-yl]oxyphenyl]-N-[3-(trifluoromethyl)phenyl]but-2-enamide (PubChem CID 123876536) has the molecular formula C30H26F3N3O3 and a molecular weight of 533.55 g/mol. Its IUPAC name is 2-[2-methyl-4-[6-(phenylmethoxymethyl)pyrimidin-4-yl]oxyphenyl]-N-[3-(trifluoromethyl)phenyl]but-2-enamide.
| Compound Name | 2-[2-methyl-4-[6-(phenylmethoxymethyl)pyrimidin-4-yl]oxyphenyl]-N-[3-(trifluoromethyl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 123876536 |
| Molecular Formula | C30H26F3N3O3 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | 2-[2-methyl-4-[6-(phenylmethoxymethyl)pyrimidin-4-yl]oxyphenyl]-N-[3-(trifluoromethyl)phenyl]but-2-enamide |
| SMILES | CC=C(C(=O)Nc1cccc(C(F)(F)F)c1)c1ccc(Oc2cc(COCc3ccccc3)ncn2)cc1C |
| InChI | InChI=1S/C30H26F3N3O3/c1-3-26(29(37)36-23-11-7-10-22(15-23)30(31,32)33)27-13-12-25(14-20(27)2)39-28-16-24(34-19-35-28)18-38-17-21-8-5-4-6-9-21/h3-16,19H,17-18H2,1-2H3,(H,36,37) |
| InChIKey | JELBBVKPAJMNGG-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|