C11H21N — CID 123876539
N,5,6-trimethyloct-5-en-4-imine (PubChem CID 123876539) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is N,5,6-trimethyloct-5-en-4-imine.
| Compound Name | N,5,6-trimethyloct-5-en-4-imine |
|---|---|
| PubChem CID | 123876539 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | N,5,6-trimethyloct-5-en-4-imine |
| SMILES | CCC/C(=N\C)C(C)=C(C)CC |
| InChI | InChI=1S/C11H21N/c1-6-8-11(12-5)10(4)9(3)7-2/h6-8H2,1-5H3/b10-9?,12-11+ |
| InChIKey | NKWWMBJRHYFEQJ-HDNPOCAZSA-N |
| XLogP | 3.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|