C16H28O3 — CID 123877570
3'-methoxy-3'a,7',7',7'a-tetramethylspiro[1,3-dioxolane-2,6'-2,3,4,5-tetrahydro-1H-indene] (PubChem CID 123877570) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is 3'-methoxy-3'a,7',7',7'a-tetramethylspiro[1,3-dioxolane-2,6'-2,3,4,5-tetrahydro-1H-indene].
| Compound Name | 3'-methoxy-3'a,7',7',7'a-tetramethylspiro[1,3-dioxolane-2,6'-2,3,4,5-tetrahydro-1H-indene] |
|---|---|
| PubChem CID | 123877570 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 3'-methoxy-3'a,7',7',7'a-tetramethylspiro[1,3-dioxolane-2,6'-2,3,4,5-tetrahydro-1H-indene] |
| SMILES | COC1CCC2(C)C1(C)CCC1(OCCO1)C2(C)C |
| InChI | InChI=1S/C16H28O3/c1-13(2)15(4)7-6-12(17-5)14(15,3)8-9-16(13)18-10-11-19-16/h12H,6-11H2,1-5H3 |
| InChIKey | WTQXZGFJUSOPSZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |