C24H43N3O6S — CID 123878908
methyl 3-[2-[butanoyl(methyl)amino]-3-[methyl-[4-methyl-2-[(3-methyl-1-oxobutan-2-yl)amino]-1-oxopentan-2-yl]amino]-3-oxopropyl]sulfanylpropanoate (PubChem CID 123878908) has the molecular formula C24H43N3O6S and a molecular weight of 501.69 g/mol. Its IUPAC name is methyl 3-[2-[butanoyl(methyl)amino]-3-[methyl-[4-methyl-2-[(3-methyl-1-oxobutan-2-yl)amino]-1-oxopentan-2-yl]amino]-3-oxopropyl]sulfanylpropanoate.
| Compound Name | methyl 3-[2-[butanoyl(methyl)amino]-3-[methyl-[4-methyl-2-[(3-methyl-1-oxobutan-2-yl)amino]-1-oxopentan-2-yl]amino]-3-oxopropyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 123878908 |
| Molecular Formula | C24H43N3O6S |
| Molecular Weight | 501.69 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | methyl 3-[2-[butanoyl(methyl)amino]-3-[methyl-[4-methyl-2-[(3-methyl-1-oxobutan-2-yl)amino]-1-oxopentan-2-yl]amino]-3-oxopropyl]sulfanylpropanoate |
| SMILES | CCCC(=O)N(C)C(CSCCC(=O)OC)C(=O)N(C)C(C=O)(CC(C)C)NC(C=O)C(C)C |
| InChI | InChI=1S/C24H43N3O6S/c1-9-10-21(30)26(6)20(15-34-12-11-22(31)33-8)23(32)27(7)24(16-29,13-17(2)3)25-19(14-28)18(4)5/h14,16-20,25H,9-13,15H2,1-8H3 |
| InChIKey | GVAXHEJDZSRLQU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.69 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|