C21H37N3O4 — CID 123648667
N,3-dimethyl-N-[3-[methyl-[4-methyl-2-[(3-methyl-1-oxobutan-2-yl)amino]-1-oxopentan-2-yl]amino]-3-oxoprop-1-en-2-yl]butanamide (PubChem CID 123648667) has the molecular formula C21H37N3O4 and a molecular weight of 395.54 g/mol. Its IUPAC name is N,3-dimethyl-N-[3-[methyl-[4-methyl-2-[(3-methyl-1-oxobutan-2-yl)amino]-1-oxopentan-2-yl]amino]-3-oxoprop-1-en-2-yl]butanamide.
| Compound Name | N,3-dimethyl-N-[3-[methyl-[4-methyl-2-[(3-methyl-1-oxobutan-2-yl)amino]-1-oxopentan-2-yl]amino]-3-oxoprop-1-en-2-yl]butanamide |
|---|---|
| PubChem CID | 123648667 |
| Molecular Formula | C21H37N3O4 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | N,3-dimethyl-N-[3-[methyl-[4-methyl-2-[(3-methyl-1-oxobutan-2-yl)amino]-1-oxopentan-2-yl]amino]-3-oxoprop-1-en-2-yl]butanamide |
| SMILES | C=C(C(=O)N(C)C(C=O)(CC(C)C)NC(C=O)C(C)C)N(C)C(=O)CC(C)C |
| InChI | InChI=1S/C21H37N3O4/c1-14(2)10-19(27)23(8)17(7)20(28)24(9)21(13-26,11-15(3)4)22-18(12-25)16(5)6/h12-16,18,22H,7,10-11H2,1-6,8-9H3 |
| InChIKey | FZUZVFRDJDQKGK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|