C26H49N3O4S — CID 130181734
N-[(2S)-3-(3-ethylpentylsulfanyl)-1-[[(2S)-4-methyl-2-[[(2R)-3-methyl-1-oxobutan-2-yl]amino]-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]-N-methylbutanamide (PubChem CID 130181734) has the molecular formula C26H49N3O4S and a molecular weight of 499.76 g/mol. Its IUPAC name is N-[(2S)-3-(3-ethylpentylsulfanyl)-1-[[(2S)-4-methyl-2-[[(2R)-3-methyl-1-oxobutan-2-yl]amino]-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]-N-methylbutanamide.
| Compound Name | N-[(2S)-3-(3-ethylpentylsulfanyl)-1-[[(2S)-4-methyl-2-[[(2R)-3-methyl-1-oxobutan-2-yl]amino]-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]-N-methylbutanamide |
|---|---|
| PubChem CID | 130181734 |
| Molecular Formula | C26H49N3O4S |
| Molecular Weight | 499.76 g/mol |
| Exact Mass | 499.34 |
| IUPAC Name | N-[(2S)-3-(3-ethylpentylsulfanyl)-1-[[(2S)-4-methyl-2-[[(2R)-3-methyl-1-oxobutan-2-yl]amino]-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]-N-methylbutanamide |
| SMILES | CCCC(=O)N(C)[C@H](CSCCC(CC)CC)C(=O)N[C@](C=O)(CC(C)C)N[C@@H](C=O)C(C)C |
| InChI | InChI=1S/C26H49N3O4S/c1-9-12-24(32)29(8)23(17-34-14-13-21(10-2)11-3)25(33)28-26(18-31,15-19(4)5)27-22(16-30)20(6)7/h16,18-23,27H,9-15,17H2,1-8H3,(H,28,33)/t22-,23+,26-/m0/s1 |
| InChIKey | JAQCLYFKXOMIIM-ZEVJAHDQSA-N |
| XLogP | 4.04 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.76 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|