C12H9BrN2 — CID 123878927
8-bromo-9-methylpyrido[3,4-b]indole (PubChem CID 123878927) has the molecular formula C12H9BrN2 and a molecular weight of 261.12 g/mol. Its IUPAC name is 8-bromo-9-methylpyrido[3,4-b]indole.
| Compound Name | 8-bromo-9-methylpyrido[3,4-b]indole |
|---|---|
| PubChem CID | 123878927 |
| Molecular Formula | C12H9BrN2 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | 8-bromo-9-methylpyrido[3,4-b]indole |
| SMILES | Cn1c2cnccc2c2cccc(Br)c21 |
| InChI | InChI=1S/C12H9BrN2/c1-15-11-7-14-6-5-8(11)9-3-2-4-10(13)12(9)15/h2-7H,1H3 |
| InChIKey | ZHPDGSZCHHARSS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |