C11H13BrN2 — CID 82499510
(7-bromo-1,2-dimethylindol-3-yl)methanamine (PubChem CID 82499510) has the molecular formula C11H13BrN2 and a molecular weight of 253.14 g/mol. Its IUPAC name is (7-bromo-1,2-dimethylindol-3-yl)methanamine.
| Compound Name | (7-bromo-1,2-dimethylindol-3-yl)methanamine |
|---|---|
| PubChem CID | 82499510 |
| Molecular Formula | C11H13BrN2 |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | (7-bromo-1,2-dimethylindol-3-yl)methanamine |
| SMILES | Cc1c(CN)c2cccc(Br)c2n1C |
| InChI | InChI=1S/C11H13BrN2/c1-7-9(6-13)8-4-3-5-10(12)11(8)14(7)2/h3-5H,6,13H2,1-2H3 |
| InChIKey | CULOFTMOMCLKFA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|