C14H14F2N4O7S — CID 123883051
[2-(benzamidocarbamoyl)-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 123883051) has the molecular formula C14H14F2N4O7S and a molecular weight of 420.35 g/mol. Its IUPAC name is [2-(benzamidocarbamoyl)-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-(benzamidocarbamoyl)-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 123883051 |
| Molecular Formula | C14H14F2N4O7S |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | [2-(benzamidocarbamoyl)-4,4-difluoro-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NNC(=O)C1CC(F)(F)C2CN1C(=O)N2OS(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C14H14F2N4O7S/c15-14(16)6-9(12(22)18-17-11(21)8-4-2-1-3-5-8)19-7-10(14)20(13(19)23)27-28(24,25)26/h1-5,9-10H,6-7H2,(H,17,21)(H,18,22)(H,24,25,26) |
| InChIKey | DMEWTYCJNSHXDQ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|