C17H20F3N5O7S — CID 145418784
[(2S)-2-[[[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 145418784) has the molecular formula C17H20F3N5O7S and a molecular weight of 495.44 g/mol. Its IUPAC name is [(2S)-2-[[[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S)-2-[[[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 145418784 |
| Molecular Formula | C17H20F3N5O7S |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | [(2S)-2-[[[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | N[C@@H](CC(=O)NNC(=O)[C@@H]1CCC2CN1C(=O)N2OS(=O)(=O)O)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H20F3N5O7S/c18-11-6-13(20)12(19)4-8(11)3-9(21)5-15(26)22-23-16(27)14-2-1-10-7-24(14)17(28)25(10)32-33(29,30)31/h4,6,9-10,14H,1-3,5,7,21H2,(H,22,26)(H,23,27)(H,29,30,31)/t9-,10?,14+/m1/s1 |
| InChIKey | POAOYMZBDVOHLW-YMNNPKDXSA-N |
| XLogP | -0.49 |
| TPSA | 171.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|