C17H20F3N5O9S — CID 161344432
[(2S,5R)-2-[amino-(2-amino-2-phenylacetyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;2,2,2-trifluoroacetic acid (PubChem CID 161344432) has the molecular formula C17H20F3N5O9S and a molecular weight of 527.43 g/mol. Its IUPAC name is [(2S,5R)-2-[amino-(2-amino-2-phenylacetyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;2,2,2-trifluoroacetic acid.
| Compound Name | [(2S,5R)-2-[amino-(2-amino-2-phenylacetyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161344432 |
| Molecular Formula | C17H20F3N5O9S |
| Molecular Weight | 527.43 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | [(2S,5R)-2-[amino-(2-amino-2-phenylacetyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;2,2,2-trifluoroacetic acid |
| SMILES | NC(C(=O)N(N)C(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O)c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H19N5O7S.C2HF3O2/c16-12(9-4-2-1-3-5-9)14(22)19(17)13(21)11-7-6-10-8-18(11)15(23)20(10)27-28(24,25)26;3-2(4,5)1(6)7/h1-5,10-12H,6-8,16-17H2,(H,24,25,26);(H,6,7)/t10-,11+,12?;/m1./s1 |
| InChIKey | VDFCEKSYVSGSMY-WCGHQRNMSA-N |
| XLogP | -0.45 |
| TPSA | 213.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.43 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|