C19H30O4 — CID 123883984
1-[4-(2,2,4-trimethylpentan-3-yl)phenoxy]propyl ethaneperoxoate (PubChem CID 123883984) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-[4-(2,2,4-trimethylpentan-3-yl)phenoxy]propyl ethaneperoxoate.
| Compound Name | 1-[4-(2,2,4-trimethylpentan-3-yl)phenoxy]propyl ethaneperoxoate |
|---|---|
| PubChem CID | 123883984 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 1-[4-(2,2,4-trimethylpentan-3-yl)phenoxy]propyl ethaneperoxoate |
| SMILES | CCC(OOC(C)=O)Oc1ccc(C(C(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H30O4/c1-8-17(23-22-14(4)20)21-16-11-9-15(10-12-16)18(13(2)3)19(5,6)7/h9-13,17-18H,8H2,1-7H3 |
| InChIKey | NJCYVXUFHXZQNI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|