C11H18 — CID 123886549
3-propan-2-yl-1,2,3,3a,4,6a-hexahydropentalene (PubChem CID 123886549) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is 3-propan-2-yl-1,2,3,3a,4,6a-hexahydropentalene.
| Compound Name | 3-propan-2-yl-1,2,3,3a,4,6a-hexahydropentalene |
|---|---|
| PubChem CID | 123886549 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 3-propan-2-yl-1,2,3,3a,4,6a-hexahydropentalene |
| SMILES | CC(C)C1CCC2C=CCC21 |
| InChI | InChI=1S/C11H18/c1-8(2)10-7-6-9-4-3-5-11(9)10/h3-4,8-11H,5-7H2,1-2H3 |
| InChIKey | UAMISUDSOLVELN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|