C42H59NO4 — CID 123892471
4-[3a-[(2-carboxycyclopropyl)methylamino]-5a,5b,8,8,11a-pentamethyl-1-(2-methylprop-2-enyl)-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid (PubChem CID 123892471) has the molecular formula C42H59NO4 and a molecular weight of 641.94 g/mol. Its IUPAC name is 4-[3a-[(2-carboxycyclopropyl)methylamino]-5a,5b,8,8,11a-pentamethyl-1-(2-methylprop-2-enyl)-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid.
| Compound Name | 4-[3a-[(2-carboxycyclopropyl)methylamino]-5a,5b,8,8,11a-pentamethyl-1-(2-methylprop-2-enyl)-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 123892471 |
| Molecular Formula | C42H59NO4 |
| Molecular Weight | 641.94 g/mol |
| Exact Mass | 641.44 |
| IUPAC Name | 4-[3a-[(2-carboxycyclopropyl)methylamino]-5a,5b,8,8,11a-pentamethyl-1-(2-methylprop-2-enyl)-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]benzoic acid |
| SMILES | C=C(C)CC1CCC2(NCC3CC3C(=O)O)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C42H59NO4/c1-25(2)22-28-14-19-42(43-24-29-23-30(29)37(46)47)21-20-40(6)32(35(28)42)12-13-34-39(5)17-15-31(26-8-10-27(11-9-26)36(44)45)38(3,4)33(39)16-18-41(34,40)7/h8-11,15,28-30,32-35,43H,1,12-14,16-24H2,2-7H3,(H,44,45)(H,46,47) |
| InChIKey | FLVYKBZZMWRWJO-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.94 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|