About 2-methyl-N,3-dioxopropanamide
2-methyl-N,3-dioxopropanamide (PubChem CID 123893329) has the molecular formula C4H5NO3
and a molecular weight of 115.09 g/mol. Its IUPAC name is 2-methyl-N,3-dioxopropanamide.
Molecular Properties
| Compound Name | 2-methyl-N,3-dioxopropanamide |
| PubChem CID | 123893329 |
| Molecular Formula | C4H5NO3 |
| Molecular Weight | 115.09 g/mol |
| Exact Mass | 115.03 |
| IUPAC Name | 2-methyl-N,3-dioxopropanamide |
| SMILES | CC(C=O)C(=O)N=O |
| InChI | InChI=1S/C4H5NO3/c1-3(2-6)4(7)5-8/h2-3H,1H3 |
| InChIKey | RSMSRONSABFUAK-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.09 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N,3-dioxopropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N,3-dioxopropanamide?
The IUPAC name of 2-methyl-N,3-dioxopropanamide (CID 123893329) is 2-methyl-N,3-dioxopropanamide.
What is the SMILES notation for 2-methyl-N,3-dioxopropanamide?
The canonical SMILES for 2-methyl-N,3-dioxopropanamide is CC(C=O)C(=O)N=O.
What is the InChIKey of 2-methyl-N,3-dioxopropanamide?
The InChIKey is RSMSRONSABFUAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3/c1-3(2-6)4(7)5-8/h2-3H,1H3.
What are the key properties of 2-methyl-N,3-dioxopropanamide?
2-methyl-N,3-dioxopropanamide has a molecular weight of 115.09 g/mol, XLogP of 0.11, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N,3-dioxopropanamide is sourced from PubChem (CID 123893329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).