C27H44N2 — CID 123897713
1,3-bis[2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]imidazolidine (PubChem CID 123897713) has the molecular formula C27H44N2 and a molecular weight of 396.66 g/mol. Its IUPAC name is 1,3-bis[2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]imidazolidine.
| Compound Name | 1,3-bis[2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]imidazolidine |
|---|---|
| PubChem CID | 123897713 |
| Molecular Formula | C27H44N2 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.35 |
| IUPAC Name | 1,3-bis[2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]imidazolidine |
| SMILES | CC(C)C1=C(N2CCN(C3=C(C(C)C)C=CCC3C(C)C)C2)C(C(C)C)CC=C1 |
| InChI | InChI=1S/C27H44N2/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8/h9-11,13,18-21,23,25H,12,14-17H2,1-8H3 |
| InChIKey | OQJVHYWFTNSXQX-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |