C19H25N — CID 58512819
N-[(6R)-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]-1-phenylmethanimine (PubChem CID 58512819) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is N-[(6R)-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]-1-phenylmethanimine.
| Compound Name | N-[(6R)-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]-1-phenylmethanimine |
|---|---|
| PubChem CID | 58512819 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | N-[(6R)-2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]-1-phenylmethanimine |
| SMILES | CC(C)C1=C(/N=C/c2ccccc2)[C@@H](C(C)C)CC=C1 |
| InChI | InChI=1S/C19H25N/c1-14(2)17-11-8-12-18(15(3)4)19(17)20-13-16-9-6-5-7-10-16/h5-11,13-15,18H,12H2,1-4H3/b20-13+/t18-/m1/s1 |
| InChIKey | DNABWTCJRSGXNA-JZQBQCRLSA-N |
| XLogP | 5.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|