C26H39N3+2 — CID 123521570
1-[2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]-3-[2,6-di(propan-2-yl)phenyl]-2H-triazole-1,3-diium (PubChem CID 123521570) has the molecular formula C26H39N3+2 and a molecular weight of 393.62 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]-3-[2,6-di(propan-2-yl)phenyl]-2H-triazole-1,3-diium.
| Compound Name | 1-[2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]-3-[2,6-di(propan-2-yl)phenyl]-2H-triazole-1,3-diium |
|---|---|
| PubChem CID | 123521570 |
| Molecular Formula | C26H39N3+2 |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 393.31 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]-3-[2,6-di(propan-2-yl)phenyl]-2H-triazole-1,3-diium |
| SMILES | CC(C)C1=C([n+]2cc[n+](-c3c(C(C)C)cccc3C(C)C)[nH]2)C(C(C)C)CC=C1 |
| InChI | InChI=1S/C26H38N3/c1-17(2)21-11-9-12-22(18(3)4)25(21)28-15-16-29(27-28)26-23(19(5)6)13-10-14-24(26)20(7)8/h9-13,15-20,24H,14H2,1-8H3/q+1/p+1 |
| InChIKey | QBGIKVJJYVTWHI-UHFFFAOYSA-O |
| XLogP | 5.92 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|