C17H25N — CID 170668990
(1Z)-6,7-di(propan-2-yl)-3,4,5,6-tetrahydro-3-benzazocine (PubChem CID 170668990) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is (1Z)-6,7-di(propan-2-yl)-3,4,5,6-tetrahydro-3-benzazocine.
| Compound Name | (1Z)-6,7-di(propan-2-yl)-3,4,5,6-tetrahydro-3-benzazocine |
|---|---|
| PubChem CID | 170668990 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | (1Z)-6,7-di(propan-2-yl)-3,4,5,6-tetrahydro-3-benzazocine |
| SMILES | CC(C)c1cccc2c1C(C(C)C)CCN/C=C\2 |
| InChI | InChI=1S/C17H25N/c1-12(2)15-7-5-6-14-8-10-18-11-9-16(13(3)4)17(14)15/h5-8,10,12-13,16,18H,9,11H2,1-4H3/b10-8- |
| InChIKey | LZEAJUTXYCHZOL-NTMALXAHSA-N |
| XLogP | 4.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |