C15H15N3O — CID 123897865
3-pyridin-3-yl-9-azabicyclo[3.3.1]non-2-ene-9-carbonyl isocyanide (PubChem CID 123897865) has the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-pyridin-3-yl-9-azabicyclo[3.3.1]non-2-ene-9-carbonyl isocyanide.
| Compound Name | 3-pyridin-3-yl-9-azabicyclo[3.3.1]non-2-ene-9-carbonyl isocyanide |
|---|---|
| PubChem CID | 123897865 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 3-pyridin-3-yl-9-azabicyclo[3.3.1]non-2-ene-9-carbonyl isocyanide |
| SMILES | [C-]#[N+]C(=O)N1C2C=C(c3cccnc3)CC1CCC2 |
| InChI | InChI=1S/C15H15N3O/c1-16-15(19)18-13-5-2-6-14(18)9-12(8-13)11-4-3-7-17-10-11/h3-4,7-8,10,13-14H,2,5-6,9H2 |
| InChIKey | PFONTGNZJPWLQI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 37.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|