C28H50F2N7O2+ — CID 123899987
3,3-diamino-2-(3-fluoro-1,7-dimethyl-7-propyl-2,3,4,5,6,8-hexahydroazonin-1-ium-9-yl)-N-[5-fluoro-4-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide (PubChem CID 123899987) has the molecular formula C28H50F2N7O2+ and a molecular weight of 554.75 g/mol. Its IUPAC name is 3,3-diamino-2-(3-fluoro-1,7-dimethyl-7-propyl-2,3,4,5,6,8-hexahydroazonin-1-ium-9-yl)-N-[5-fluoro-4-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(3-fluoro-1,7-dimethyl-7-propyl-2,3,4,5,6,8-hexahydroazonin-1-ium-9-yl)-N-[5-fluoro-4-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 123899987 |
| Molecular Formula | C28H50F2N7O2+ |
| Molecular Weight | 554.75 g/mol |
| Exact Mass | 554.40 |
| IUPAC Name | 3,3-diamino-2-(3-fluoro-1,7-dimethyl-7-propyl-2,3,4,5,6,8-hexahydroazonin-1-ium-9-yl)-N-[5-fluoro-4-(6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide |
| SMILES | CCCC1(C)CCCC(F)C/[N+](C)=C(/C(C(=O)NC2CNCC(F)C2N2CCN3C(=O)CCC3C2)C(N)N)C1 |
| InChI | InChI=1S/C28H49F2N7O2/c1-4-9-28(2)10-5-6-18(29)16-35(3)22(13-28)24(26(31)32)27(39)34-21-15-33-14-20(30)25(21)36-11-12-37-19(17-36)7-8-23(37)38/h18-21,24-26,33H,4-17,31-32H2,1-3H3/p+1/b35-22+ |
| InChIKey | WXKKRORRQAZYPL-FADJLKOXSA-O |
| XLogP | 0.75 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.75 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|