C33H62FN7O — CID 123215706
3-(6-cyclobutyl-2-fluorononyl)imino-2-(diaminomethyl)-N-[4-(2,8-diazaspiro[4.5]decan-8-yl)piperidin-3-yl]hexanamide (PubChem CID 123215706) has the molecular formula C33H62FN7O and a molecular weight of 591.91 g/mol. Its IUPAC name is 3-(6-cyclobutyl-2-fluorononyl)imino-2-(diaminomethyl)-N-[4-(2,8-diazaspiro[4.5]decan-8-yl)piperidin-3-yl]hexanamide.
| Compound Name | 3-(6-cyclobutyl-2-fluorononyl)imino-2-(diaminomethyl)-N-[4-(2,8-diazaspiro[4.5]decan-8-yl)piperidin-3-yl]hexanamide |
|---|---|
| PubChem CID | 123215706 |
| Molecular Formula | C33H62FN7O |
| Molecular Weight | 591.91 g/mol |
| Exact Mass | 591.50 |
| IUPAC Name | 3-(6-cyclobutyl-2-fluorononyl)imino-2-(diaminomethyl)-N-[4-(2,8-diazaspiro[4.5]decan-8-yl)piperidin-3-yl]hexanamide |
| SMILES | CCC/C(=N\CC(F)CCCC(CCC)C1CCC1)C(C(=O)NC1CNCCC1N1CCC2(CCNC2)CC1)C(N)N |
| InChI | InChI=1S/C33H62FN7O/c1-3-7-24(25-9-5-10-25)11-6-12-26(34)21-39-27(8-4-2)30(31(35)36)32(42)40-28-22-37-17-13-29(28)41-19-15-33(16-20-41)14-18-38-23-33/h24-26,28-31,37-38H,3-23,35-36H2,1-2H3,(H,40,42)/b39-27+ |
| InChIKey | CXKQYLQJDYKSCC-XOKHWMEBSA-N |
| XLogP | 3.73 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.91 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|