C15H22O3 — CID 123900998
2-[1-(5-ethylcyclohepta-1,3,6-trien-1-yl)oxyethoxymethyl]oxetane (PubChem CID 123900998) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-[1-(5-ethylcyclohepta-1,3,6-trien-1-yl)oxyethoxymethyl]oxetane.
| Compound Name | 2-[1-(5-ethylcyclohepta-1,3,6-trien-1-yl)oxyethoxymethyl]oxetane |
|---|---|
| PubChem CID | 123900998 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2-[1-(5-ethylcyclohepta-1,3,6-trien-1-yl)oxyethoxymethyl]oxetane |
| SMILES | CCC1C=CC=C(OC(C)OCC2CCO2)C=C1 |
| InChI | InChI=1S/C15H22O3/c1-3-13-5-4-6-14(8-7-13)18-12(2)17-11-15-9-10-16-15/h4-8,12-13,15H,3,9-11H2,1-2H3 |
| InChIKey | PGUHAINRSCUZEW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|