C20H25N3 — CID 123904637
7-ethyl-1,8-dimethyl-N-[(3Z)-4-methylhepta-1,3,6-trien-2-yl]-2,7-naphthyridin-3-imine (PubChem CID 123904637) has the molecular formula C20H25N3 and a molecular weight of 307.44 g/mol. Its IUPAC name is 7-ethyl-1,8-dimethyl-N-[(3Z)-4-methylhepta-1,3,6-trien-2-yl]-2,7-naphthyridin-3-imine.
| Compound Name | 7-ethyl-1,8-dimethyl-N-[(3Z)-4-methylhepta-1,3,6-trien-2-yl]-2,7-naphthyridin-3-imine |
|---|---|
| PubChem CID | 123904637 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 7-ethyl-1,8-dimethyl-N-[(3Z)-4-methylhepta-1,3,6-trien-2-yl]-2,7-naphthyridin-3-imine |
| SMILES | C=CC/C(C)=C\C(=C)/N=c1/cc2ccn(CC)c(C)c-2c(C)n1 |
| InChI | InChI=1S/C20H25N3/c1-7-9-14(3)12-15(4)21-19-13-18-10-11-23(8-2)17(6)20(18)16(5)22-19/h7,10-13H,1,4,8-9H2,2-3,5-6H3/b14-12-,21-19- |
| InChIKey | RDUZBXMYVFLPSF-CFLPNQBOSA-N |
| XLogP | 4.56 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|