C31H44N2O5S2Si2 — CID 123906909
5-[[5-[3,3-bis[[tert-butyl(methyl)silyl]oxy]-3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propyl]thiophen-2-yl]methyl]-4-hydroxy-3H-1,3-thiazol-2-one (PubChem CID 123906909) has the molecular formula C31H44N2O5S2Si2 and a molecular weight of 645.01 g/mol. Its IUPAC name is 5-[[5-[3,3-bis[[tert-butyl(methyl)silyl]oxy]-3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propyl]thiophen-2-yl]methyl]-4-hydroxy-3H-1,3-thiazol-2-one.
| Compound Name | 5-[[5-[3,3-bis[[tert-butyl(methyl)silyl]oxy]-3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propyl]thiophen-2-yl]methyl]-4-hydroxy-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 123906909 |
| Molecular Formula | C31H44N2O5S2Si2 |
| Molecular Weight | 645.01 g/mol |
| Exact Mass | 644.22 |
| IUPAC Name | 5-[[5-[3,3-bis[[tert-butyl(methyl)silyl]oxy]-3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propyl]thiophen-2-yl]methyl]-4-hydroxy-3H-1,3-thiazol-2-one |
| SMILES | Cc1oc(-c2ccccc2)nc1C(CCc1ccc(Cc2sc(=O)[nH]c2O)s1)(O[SiH](C)C(C)(C)C)O[SiH](C)C(C)(C)C |
| InChI | InChI=1S/C31H44N2O5S2Si2/c1-20-25(32-27(36-20)21-13-11-10-12-14-21)31(37-41(8)29(2,3)4,38-42(9)30(5,6)7)18-17-22-15-16-23(39-22)19-24-26(34)33-28(35)40-24/h10-16,34,41-42H,17-19H2,1-9H3,(H,33,35) |
| InChIKey | UUNNKBYGLAIYSP-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 97.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.01 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|