C29H44N2O7 — CID 123907416
(4aS,5aS,12aS)-7-(dimethylamino)-9-(3-ethylcyclohexyl)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11a-tetradecahydrotetracene-2-carboxamide (PubChem CID 123907416) has the molecular formula C29H44N2O7 and a molecular weight of 532.68 g/mol. Its IUPAC name is (4aS,5aS,12aS)-7-(dimethylamino)-9-(3-ethylcyclohexyl)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11a-tetradecahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aS,12aS)-7-(dimethylamino)-9-(3-ethylcyclohexyl)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11a-tetradecahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123907416 |
| Molecular Formula | C29H44N2O7 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | (4aS,5aS,12aS)-7-(dimethylamino)-9-(3-ethylcyclohexyl)-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11a-tetradecahydrotetracene-2-carboxamide |
| SMILES | CCC1CCCC(C2CC(N(C)C)C3C[C@H]4C[C@H]5CC(O)C(C(N)=O)C(=O)[C@@]5(O)C(=O)C4C(=O)C3C2O)C1 |
| InChI | InChI=1S/C29H44N2O7/c1-4-13-6-5-7-14(8-13)17-12-19(31(2)3)18-10-15-9-16-11-20(32)23(28(30)37)27(36)29(16,38)26(35)21(15)25(34)22(18)24(17)33/h13-24,32-33,38H,4-12H2,1-3H3,(H2,30,37)/t13?,14?,15-,16+,17?,18?,19?,20?,21?,22?,23?,24?,29+/m1/s1 |
| InChIKey | HVYLJDNWMWVMMG-DPMLMYSQSA-N |
| XLogP | 0.71 |
| TPSA | 158.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|