C27H42N2O6S2 — CID 123911324
(1S,4R,8R,11S)-15-methyl-8-[(E)-4-methylsulfanylbut-1-enyl]-4,11-di(propan-2-yl)-9-oxa-16-thia-2,12-diazabicyclo[12.3.2]nonadecane-3,6,10,13,18-pentone (PubChem CID 123911324) has the molecular formula C27H42N2O6S2 and a molecular weight of 554.78 g/mol. Its IUPAC name is (1S,4R,8R,11S)-15-methyl-8-[(E)-4-methylsulfanylbut-1-enyl]-4,11-di(propan-2-yl)-9-oxa-16-thia-2,12-diazabicyclo[12.3.2]nonadecane-3,6,10,13,18-pentone.
| Compound Name | (1S,4R,8R,11S)-15-methyl-8-[(E)-4-methylsulfanylbut-1-enyl]-4,11-di(propan-2-yl)-9-oxa-16-thia-2,12-diazabicyclo[12.3.2]nonadecane-3,6,10,13,18-pentone |
|---|---|
| PubChem CID | 123911324 |
| Molecular Formula | C27H42N2O6S2 |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | (1S,4R,8R,11S)-15-methyl-8-[(E)-4-methylsulfanylbut-1-enyl]-4,11-di(propan-2-yl)-9-oxa-16-thia-2,12-diazabicyclo[12.3.2]nonadecane-3,6,10,13,18-pentone |
| SMILES | CSCC/C=C/[C@H]1CC(=O)C[C@H](C(C)C)C(=O)N[C@@H]2CSC(C)C(CC2=O)C(=O)N[C@@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C27H42N2O6S2/c1-15(2)20-12-18(30)11-19(9-7-8-10-36-6)35-27(34)24(16(3)4)29-26(33)21-13-23(31)22(28-25(20)32)14-37-17(21)5/h7,9,15-17,19-22,24H,8,10-14H2,1-6H3,(H,28,32)(H,29,33)/b9-7+/t17?,19-,20+,21?,22+,24-/m0/s1 |
| InChIKey | KKDMHRZUDMHIKB-MIYXSLTNSA-N |
| XLogP | 3.18 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|