C24H20B2F12-2 — CID 123916678
benzyl-[3,5-bis(trifluoromethyl)phenyl]boranuide;[3,5-bis(trifluoromethyl)phenyl]-methylboranuide (PubChem CID 123916678) has the molecular formula C24H20B2F12-2 and a molecular weight of 558.02 g/mol. Its IUPAC name is benzyl-[3,5-bis(trifluoromethyl)phenyl]boranuide;[3,5-bis(trifluoromethyl)phenyl]-methylboranuide.
| Compound Name | benzyl-[3,5-bis(trifluoromethyl)phenyl]boranuide;[3,5-bis(trifluoromethyl)phenyl]-methylboranuide |
|---|---|
| PubChem CID | 123916678 |
| Molecular Formula | C24H20B2F12-2 |
| Molecular Weight | 558.02 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | benzyl-[3,5-bis(trifluoromethyl)phenyl]boranuide;[3,5-bis(trifluoromethyl)phenyl]-methylboranuide |
| SMILES | C[BH2-]c1cc(C(F)(F)F)cc(C(F)(F)F)c1.FC(F)(F)c1cc([BH2-]Cc2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12BF6.C9H8BF6/c17-14(18,19)11-6-12(15(20,21)22)8-13(7-11)16-9-10-4-2-1-3-5-10;1-10-7-3-5(8(11,12)13)2-6(4-7)9(14,15)16/h1-8H,9,16H2;2-4H,10H2,1H3/q2*-1 |
| InChIKey | IZNYWCHFYPUQQP-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.02 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|