C23H41N — CID 123928685
N-[7-(2,2-dimethylbutyl)-5,9,10-trimethyl-4-methylidenedodeca-6,10-dien-6-yl]methanimine (PubChem CID 123928685) has the molecular formula C23H41N and a molecular weight of 331.59 g/mol. Its IUPAC name is N-[7-(2,2-dimethylbutyl)-5,9,10-trimethyl-4-methylidenedodeca-6,10-dien-6-yl]methanimine.
| Compound Name | N-[7-(2,2-dimethylbutyl)-5,9,10-trimethyl-4-methylidenedodeca-6,10-dien-6-yl]methanimine |
|---|---|
| PubChem CID | 123928685 |
| Molecular Formula | C23H41N |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 331.32 |
| IUPAC Name | N-[7-(2,2-dimethylbutyl)-5,9,10-trimethyl-4-methylidenedodeca-6,10-dien-6-yl]methanimine |
| SMILES | C=NC(=C(CC(C)C(C)=CC)CC(C)(C)CC)C(C)C(=C)CCC |
| InChI | InChI=1S/C23H41N/c1-11-14-18(5)20(7)22(24-10)21(16-23(8,9)13-3)15-19(6)17(4)12-2/h12,19-20H,5,10-11,13-16H2,1-4,6-9H3 |
| InChIKey | PRRATCDSKJEOBX-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|