C17H31N — CID 144504826
N-[(2Z,4Z)-6,7,7,9,9-pentamethylundeca-2,4-dien-5-yl]methanimine (PubChem CID 144504826) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is N-[(2Z,4Z)-6,7,7,9,9-pentamethylundeca-2,4-dien-5-yl]methanimine.
| Compound Name | N-[(2Z,4Z)-6,7,7,9,9-pentamethylundeca-2,4-dien-5-yl]methanimine |
|---|---|
| PubChem CID | 144504826 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | N-[(2Z,4Z)-6,7,7,9,9-pentamethylundeca-2,4-dien-5-yl]methanimine |
| SMILES | C=N/C(=C\C=C/C)C(C)C(C)(C)CC(C)(C)CC |
| InChI | InChI=1S/C17H31N/c1-9-11-12-15(18-8)14(3)17(6,7)13-16(4,5)10-2/h9,11-12,14H,8,10,13H2,1-7H3/b11-9-,15-12- |
| InChIKey | DRECPDHDFCQTGG-PWLMUZNSSA-N |
| XLogP | 5.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|