C19H37N — CID 144504970
ethane;N-[(3Z)-5,6,6,8,8,9-hexamethyldeca-1,3-dien-4-yl]methanimine (PubChem CID 144504970) has the molecular formula C19H37N and a molecular weight of 279.51 g/mol. Its IUPAC name is ethane;N-[(3Z)-5,6,6,8,8,9-hexamethyldeca-1,3-dien-4-yl]methanimine.
| Compound Name | ethane;N-[(3Z)-5,6,6,8,8,9-hexamethyldeca-1,3-dien-4-yl]methanimine |
|---|---|
| PubChem CID | 144504970 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | ethane;N-[(3Z)-5,6,6,8,8,9-hexamethyldeca-1,3-dien-4-yl]methanimine |
| SMILES | C=C/C=C(\N=C)C(C)C(C)(C)CC(C)(C)C(C)C.CC |
| InChI | InChI=1S/C17H31N.C2H6/c1-10-11-15(18-9)14(4)17(7,8)12-16(5,6)13(2)3;1-2/h10-11,13-14H,1,9,12H2,2-8H3;1-2H3/b15-11-; |
| InChIKey | QAEIZBIPFHZMNT-PNCOJPCNSA-N |
| XLogP | 6.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|