C21H31BrN2O5 — CID 123929810
tert-butyl 2-[[2-[(4-bromophenyl)carbamoyloxy]-4-methylpentanoyl]-ethylamino]acetate (PubChem CID 123929810) has the molecular formula C21H31BrN2O5 and a molecular weight of 471.39 g/mol. Its IUPAC name is tert-butyl 2-[[2-[(4-bromophenyl)carbamoyloxy]-4-methylpentanoyl]-ethylamino]acetate.
| Compound Name | tert-butyl 2-[[2-[(4-bromophenyl)carbamoyloxy]-4-methylpentanoyl]-ethylamino]acetate |
|---|---|
| PubChem CID | 123929810 |
| Molecular Formula | C21H31BrN2O5 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | tert-butyl 2-[[2-[(4-bromophenyl)carbamoyloxy]-4-methylpentanoyl]-ethylamino]acetate |
| SMILES | CCN(CC(=O)OC(C)(C)C)C(=O)C(CC(C)C)OC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C21H31BrN2O5/c1-7-24(13-18(25)29-21(4,5)6)19(26)17(12-14(2)3)28-20(27)23-16-10-8-15(22)9-11-16/h8-11,14,17H,7,12-13H2,1-6H3,(H,23,27) |
| InChIKey | ZCKWPXNLDSHEFR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |