C14H34OSi2 — CID 123931360
methyl-(2,4,4,6,6-pentamethyl-7-methylsilylheptan-2-yl)oxysilane (PubChem CID 123931360) has the molecular formula C14H34OSi2 and a molecular weight of 274.60 g/mol. Its IUPAC name is methyl-(2,4,4,6,6-pentamethyl-7-methylsilylheptan-2-yl)oxysilane.
| Compound Name | methyl-(2,4,4,6,6-pentamethyl-7-methylsilylheptan-2-yl)oxysilane |
|---|---|
| PubChem CID | 123931360 |
| Molecular Formula | C14H34OSi2 |
| Molecular Weight | 274.60 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | methyl-(2,4,4,6,6-pentamethyl-7-methylsilylheptan-2-yl)oxysilane |
| SMILES | C[SiH2]CC(C)(C)CC(C)(C)CC(C)(C)O[SiH2]C |
| InChI | InChI=1S/C14H34OSi2/c1-12(2,9-13(3,4)11-16-7)10-14(5,6)15-17-8/h9-11,16-17H2,1-8H3 |
| InChIKey | XQVHPRUBSLAQQR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.60 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|