C25H24FN7O2 — CID 123932886
[(3S,9aS)-3-(4-fluoro-3-isocyanophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[5-(tetrazol-1-yl)-2,3-dihydro-1H-inden-1-yl]methanone (PubChem CID 123932886) has the molecular formula C25H24FN7O2 and a molecular weight of 473.51 g/mol. Its IUPAC name is [(3S,9aS)-3-(4-fluoro-3-isocyanophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[5-(tetrazol-1-yl)-2,3-dihydro-1H-inden-1-yl]methanone.
| Compound Name | [(3S,9aS)-3-(4-fluoro-3-isocyanophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[5-(tetrazol-1-yl)-2,3-dihydro-1H-inden-1-yl]methanone |
|---|---|
| PubChem CID | 123932886 |
| Molecular Formula | C25H24FN7O2 |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | [(3S,9aS)-3-(4-fluoro-3-isocyanophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-[5-(tetrazol-1-yl)-2,3-dihydro-1H-inden-1-yl]methanone |
| SMILES | [C-]#[N+]c1cc([C@H]2CN3CCN(C(=O)C4CCc5cc(-n6cnnn6)ccc54)C[C@H]3CO2)ccc1F |
| InChI | InChI=1S/C25H24FN7O2/c1-27-23-11-17(3-7-22(23)26)24-13-31-8-9-32(12-19(31)14-35-24)25(34)21-5-2-16-10-18(4-6-20(16)21)33-15-28-29-30-33/h3-4,6-7,10-11,15,19,21,24H,2,5,8-9,12-14H2/t19-,21?,24+/m0/s1 |
| InChIKey | PPWGGZMLHUAYFM-LDEFDFMYSA-N |
| XLogP | 2.67 |
| TPSA | 80.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|