C11H16N2O4 — CID 123936597
5-(2,5-dihydroxypyrrol-1-yl)-N-(2-oxoethyl)pentanamide (PubChem CID 123936597) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 5-(2,5-dihydroxypyrrol-1-yl)-N-(2-oxoethyl)pentanamide.
| Compound Name | 5-(2,5-dihydroxypyrrol-1-yl)-N-(2-oxoethyl)pentanamide |
|---|---|
| PubChem CID | 123936597 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 5-(2,5-dihydroxypyrrol-1-yl)-N-(2-oxoethyl)pentanamide |
| SMILES | O=CCNC(=O)CCCCn1c(O)ccc1O |
| InChI | InChI=1S/C11H16N2O4/c14-8-6-12-9(15)3-1-2-7-13-10(16)4-5-11(13)17/h4-5,8,16-17H,1-3,6-7H2,(H,12,15) |
| InChIKey | QTTLFAPRJXZOHP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|