C33H40BrN5O4 — CID 123939375
ethyl 2-[6-(3-bromophenoxy)-2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxymethyl]amino]purin-9-yl]acetate (PubChem CID 123939375) has the molecular formula C33H40BrN5O4 and a molecular weight of 650.62 g/mol. Its IUPAC name is ethyl 2-[6-(3-bromophenoxy)-2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxymethyl]amino]purin-9-yl]acetate.
| Compound Name | ethyl 2-[6-(3-bromophenoxy)-2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxymethyl]amino]purin-9-yl]acetate |
|---|---|
| PubChem CID | 123939375 |
| Molecular Formula | C33H40BrN5O4 |
| Molecular Weight | 650.62 g/mol |
| Exact Mass | 649.23 |
| IUPAC Name | ethyl 2-[6-(3-bromophenoxy)-2-[(4-cyclohexylphenyl)methyl-[(2-methylpropan-2-yl)oxymethyl]amino]purin-9-yl]acetate |
| SMILES | CCOC(=O)Cn1cnc2c(Oc3cccc(Br)c3)nc(N(COC(C)(C)C)Cc3ccc(C4CCCCC4)cc3)nc21 |
| InChI | InChI=1S/C33H40BrN5O4/c1-5-41-28(40)20-38-21-35-29-30(38)36-32(37-31(29)43-27-13-9-12-26(34)18-27)39(22-42-33(2,3)4)19-23-14-16-25(17-15-23)24-10-7-6-8-11-24/h9,12-18,21,24H,5-8,10-11,19-20,22H2,1-4H3 |
| InChIKey | RXKIXEIJDIABEZ-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 91.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.62 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|