C30H62 — CID 123942222
14-butyl-8-ethyl-3,12,16,17-tetramethylicosane (PubChem CID 123942222) has the molecular formula C30H62 and a molecular weight of 422.83 g/mol. Its IUPAC name is 14-butyl-8-ethyl-3,12,16,17-tetramethylicosane.
| Compound Name | 14-butyl-8-ethyl-3,12,16,17-tetramethylicosane |
|---|---|
| PubChem CID | 123942222 |
| Molecular Formula | C30H62 |
| Molecular Weight | 422.83 g/mol |
| Exact Mass | 422.49 |
| IUPAC Name | 14-butyl-8-ethyl-3,12,16,17-tetramethylicosane |
| SMILES | CCCCC(CC(C)CCCC(CC)CCCCC(C)CC)CC(C)C(C)CCC |
| InChI | InChI=1S/C30H62/c1-9-13-20-30(24-28(8)27(7)17-10-2)23-26(6)19-16-22-29(12-4)21-15-14-18-25(5)11-3/h25-30H,9-24H2,1-8H3 |
| InChIKey | XWQYTPKMLHCLQQ-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.83 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|