C14H16F3NOS — CID 123946553
(E)-5-methyl-6-[[6-methyl-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]hex-4-en-2-one (PubChem CID 123946553) has the molecular formula C14H16F3NOS and a molecular weight of 303.35 g/mol. Its IUPAC name is (E)-5-methyl-6-[[6-methyl-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]hex-4-en-2-one.
| Compound Name | (E)-5-methyl-6-[[6-methyl-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]hex-4-en-2-one |
|---|---|
| PubChem CID | 123946553 |
| Molecular Formula | C14H16F3NOS |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | (E)-5-methyl-6-[[6-methyl-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]hex-4-en-2-one |
| SMILES | CC(=O)C/C=C(\C)CSc1ccc(C(F)(F)F)c(C)n1 |
| InChI | InChI=1S/C14H16F3NOS/c1-9(4-5-10(2)19)8-20-13-7-6-12(11(3)18-13)14(15,16)17/h4,6-7H,5,8H2,1-3H3/b9-4+ |
| InChIKey | NVWBMLDIAGURCO-RUDMXATFSA-N |
| XLogP | 4.43 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|