C19H38O4Si — CID 123949510
tert-butyl 3-[2-[tert-butyl(dimethyl)silyl]oxy-4-(hydroxymethyl)cyclopentyl]propanoate (PubChem CID 123949510) has the molecular formula C19H38O4Si and a molecular weight of 358.60 g/mol. Its IUPAC name is tert-butyl 3-[2-[tert-butyl(dimethyl)silyl]oxy-4-(hydroxymethyl)cyclopentyl]propanoate.
| Compound Name | tert-butyl 3-[2-[tert-butyl(dimethyl)silyl]oxy-4-(hydroxymethyl)cyclopentyl]propanoate |
|---|---|
| PubChem CID | 123949510 |
| Molecular Formula | C19H38O4Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | tert-butyl 3-[2-[tert-butyl(dimethyl)silyl]oxy-4-(hydroxymethyl)cyclopentyl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCC1CC(CO)CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O4Si/c1-18(2,3)22-17(21)10-9-15-11-14(13-20)12-16(15)23-24(7,8)19(4,5)6/h14-16,20H,9-13H2,1-8H3 |
| InChIKey | NXZRGPOKEMZVJS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|