C13H21N3 — CID 123952851
N-methyl-N-(6-methylidene-3-methyliminoocta-1,4-dien-2-yl)ethanimidamide (PubChem CID 123952851) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is N-methyl-N-(6-methylidene-3-methyliminoocta-1,4-dien-2-yl)ethanimidamide.
| Compound Name | N-methyl-N-(6-methylidene-3-methyliminoocta-1,4-dien-2-yl)ethanimidamide |
|---|---|
| PubChem CID | 123952851 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N-methyl-N-(6-methylidene-3-methyliminoocta-1,4-dien-2-yl)ethanimidamide |
| SMILES | [H]/N=C(\C)N(C)C(=C)/C(C=CC(=C)CC)=N/C |
| InChI | InChI=1S/C13H21N3/c1-7-10(2)8-9-13(15-5)11(3)16(6)12(4)14/h8-9,14H,2-3,7H2,1,4-6H3/b9-8?,14-12+,15-13+ |
| InChIKey | RMEFZXHOTDTGJG-ROHRVJQWSA-N |
| XLogP | 3.02 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|