C28H28F5N5O3S — CID 123953151
N-(1-cyano-3,3,3-trifluoropropyl)-2-[3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrazolo[1,5-a]pyridin-2-yl]-5,5-difluorocyclohexane-1-carboxamide (PubChem CID 123953151) has the molecular formula C28H28F5N5O3S and a molecular weight of 609.62 g/mol. Its IUPAC name is N-(1-cyano-3,3,3-trifluoropropyl)-2-[3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrazolo[1,5-a]pyridin-2-yl]-5,5-difluorocyclohexane-1-carboxamide.
| Compound Name | N-(1-cyano-3,3,3-trifluoropropyl)-2-[3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrazolo[1,5-a]pyridin-2-yl]-5,5-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 123953151 |
| Molecular Formula | C28H28F5N5O3S |
| Molecular Weight | 609.62 g/mol |
| Exact Mass | 609.18 |
| IUPAC Name | N-(1-cyano-3,3,3-trifluoropropyl)-2-[3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrazolo[1,5-a]pyridin-2-yl]-5,5-difluorocyclohexane-1-carboxamide |
| SMILES | N#CC(CC(F)(F)F)NC(=O)C1CC(F)(F)CCC1c1nn2ccccc2c1-c1ccc(N2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C28H28F5N5O3S/c29-27(30)9-8-21(22(16-27)26(39)35-19(17-34)15-28(31,32)33)25-24(23-3-1-2-10-38(23)36-25)18-4-6-20(7-5-18)37-11-13-42(40,41)14-12-37/h1-7,10,19,21-22H,8-9,11-16H2,(H,35,39) |
| InChIKey | SHYIWOIFNSOPFK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 107.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.62 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |