C29H29F5N4O3S — CID 161079732
2-[2-[(1R,2R)-2-[3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrazolo[1,5-a]pyridin-2-yl]-5,5-difluorocyclohexyl]-2-oxoethyl]-4,4,4-trifluorobutanenitrile (PubChem CID 161079732) has the molecular formula C29H29F5N4O3S and a molecular weight of 608.63 g/mol. Its IUPAC name is 2-[2-[(1R,2R)-2-[3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrazolo[1,5-a]pyridin-2-yl]-5,5-difluorocyclohexyl]-2-oxoethyl]-4,4,4-trifluorobutanenitrile.
| Compound Name | 2-[2-[(1R,2R)-2-[3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrazolo[1,5-a]pyridin-2-yl]-5,5-difluorocyclohexyl]-2-oxoethyl]-4,4,4-trifluorobutanenitrile |
|---|---|
| PubChem CID | 161079732 |
| Molecular Formula | C29H29F5N4O3S |
| Molecular Weight | 608.63 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | 2-[2-[(1R,2R)-2-[3-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrazolo[1,5-a]pyridin-2-yl]-5,5-difluorocyclohexyl]-2-oxoethyl]-4,4,4-trifluorobutanenitrile |
| SMILES | N#CC(CC(=O)[C@@H]1CC(F)(F)CC[C@H]1c1nn2ccccc2c1-c1ccc(N2CCS(=O)(=O)CC2)cc1)CC(F)(F)F |
| InChI | InChI=1S/C29H29F5N4O3S/c30-28(31)9-8-22(23(17-28)25(39)15-19(18-35)16-29(32,33)34)27-26(24-3-1-2-10-38(24)36-27)20-4-6-21(7-5-20)37-11-13-42(40,41)14-12-37/h1-7,10,19,22-23H,8-9,11-17H2/t19?,22-,23-/m1/s1 |
| InChIKey | UFTGRQOWIVCPGS-QENMJEOYSA-N |
| XLogP | 5.81 |
| TPSA | 95.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |