C14H15F3N5O2S- — CID 123953647
1-[2,5-difluoro-4-[(sulfinatoamino)methyl]phenyl]-3-fluoro-4-(1,2,4-triazol-4-yl)piperidine (PubChem CID 123953647) has the molecular formula C14H15F3N5O2S- and a molecular weight of 374.37 g/mol. Its IUPAC name is 1-[2,5-difluoro-4-[(sulfinatoamino)methyl]phenyl]-3-fluoro-4-(1,2,4-triazol-4-yl)piperidine.
| Compound Name | 1-[2,5-difluoro-4-[(sulfinatoamino)methyl]phenyl]-3-fluoro-4-(1,2,4-triazol-4-yl)piperidine |
|---|---|
| PubChem CID | 123953647 |
| Molecular Formula | C14H15F3N5O2S- |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 1-[2,5-difluoro-4-[(sulfinatoamino)methyl]phenyl]-3-fluoro-4-(1,2,4-triazol-4-yl)piperidine |
| SMILES | O=S([O-])NCc1cc(F)c(N2CCC(n3cnnc3)C(F)C2)cc1F |
| InChI | InChI=1S/C14H16F3N5O2S/c15-10-4-14(11(16)3-9(10)5-20-25(23)24)21-2-1-13(12(17)6-21)22-7-18-19-8-22/h3-4,7-8,12-13,20H,1-2,5-6H2,(H,23,24)/p-1 |
| InChIKey | NCOUUXAAYHKUKT-UHFFFAOYSA-M |
| XLogP | 1.23 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|