C32H33ClN2O4 — CID 123954334
(2S)-2-[3-chloro-5-[[5-[2-(3-cyclopropylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenoxy]propanoic acid (PubChem CID 123954334) has the molecular formula C32H33ClN2O4 and a molecular weight of 545.08 g/mol. Its IUPAC name is (2S)-2-[3-chloro-5-[[5-[2-(3-cyclopropylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenoxy]propanoic acid.
| Compound Name | (2S)-2-[3-chloro-5-[[5-[2-(3-cyclopropylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 123954334 |
| Molecular Formula | C32H33ClN2O4 |
| Molecular Weight | 545.08 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | (2S)-2-[3-chloro-5-[[5-[2-(3-cyclopropylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenoxy]propanoic acid |
| SMILES | Cc1c(C)n(Cc2cc(Cl)cc(O[C@@H](C)C(=O)O)c2)c2ccc(C(=O)NCCc3cccc(C4CC4)c3)cc12 |
| InChI | InChI=1S/C32H33ClN2O4/c1-19-20(2)35(18-23-14-27(33)17-28(15-23)39-21(3)32(37)38)30-10-9-26(16-29(19)30)31(36)34-12-11-22-5-4-6-25(13-22)24-7-8-24/h4-6,9-10,13-17,21,24H,7-8,11-12,18H2,1-3H3,(H,34,36)(H,37,38)/t21-/m0/s1 |
| InChIKey | MSZPEVYLWBYGQW-NRFANRHFSA-N |
| XLogP | 6.66 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.08 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|