C37H38F3N2O2+ — CID 123955584
14,15-diethyl-15-(4-methoxypent-3-en-2-yloxy)-14-methyl-10-phenyl-18-(trifluoromethyl)-10-aza-16-azoniapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1(13),2,4,6,8,11,16(21),17,19-nonaene (PubChem CID 123955584) has the molecular formula C37H38F3N2O2+ and a molecular weight of 599.72 g/mol. Its IUPAC name is 14,15-diethyl-15-(4-methoxypent-3-en-2-yloxy)-14-methyl-10-phenyl-18-(trifluoromethyl)-10-aza-16-azoniapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1(13),2,4,6,8,11,16(21),17,19-nonaene.
| Compound Name | 14,15-diethyl-15-(4-methoxypent-3-en-2-yloxy)-14-methyl-10-phenyl-18-(trifluoromethyl)-10-aza-16-azoniapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1(13),2,4,6,8,11,16(21),17,19-nonaene |
|---|---|
| PubChem CID | 123955584 |
| Molecular Formula | C37H38F3N2O2+ |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.29 |
| IUPAC Name | 14,15-diethyl-15-(4-methoxypent-3-en-2-yloxy)-14-methyl-10-phenyl-18-(trifluoromethyl)-10-aza-16-azoniapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1(13),2,4,6,8,11,16(21),17,19-nonaene |
| SMILES | CCC1(C)c2cc3c(cc2-c2ccc(C(F)(F)F)c[n+]2C1(CC)OC(C)C=C(C)OC)c1ccccc1n3-c1ccccc1 |
| InChI | InChI=1S/C37H38F3N2O2/c1-7-35(5)31-22-34-29(28-16-12-13-17-33(28)42(34)27-14-10-9-11-15-27)21-30(31)32-19-18-26(37(38,39)40)23-41(32)36(35,8-2)44-25(4)20-24(3)43-6/h9-23,25H,7-8H2,1-6H3/q+1 |
| InChIKey | YYFZTNATBDPONQ-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|