C36H38F6NO2+ — CID 123367364
6-butyl-12,12-diethyl-13-(1,1,1,5,5,5-hexafluoro-4-methoxypent-3-en-2-yl)oxy-13-methyl-14-azoniapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaene (PubChem CID 123367364) has the molecular formula C36H38F6NO2+ and a molecular weight of 630.69 g/mol. Its IUPAC name is 6-butyl-12,12-diethyl-13-(1,1,1,5,5,5-hexafluoro-4-methoxypent-3-en-2-yl)oxy-13-methyl-14-azoniapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaene.
| Compound Name | 6-butyl-12,12-diethyl-13-(1,1,1,5,5,5-hexafluoro-4-methoxypent-3-en-2-yl)oxy-13-methyl-14-azoniapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaene |
|---|---|
| PubChem CID | 123367364 |
| Molecular Formula | C36H38F6NO2+ |
| Molecular Weight | 630.69 g/mol |
| Exact Mass | 630.28 |
| IUPAC Name | 6-butyl-12,12-diethyl-13-(1,1,1,5,5,5-hexafluoro-4-methoxypent-3-en-2-yl)oxy-13-methyl-14-azoniapentacyclo[12.8.0.02,11.04,9.015,20]docosa-1(14),2(11),3,5,7,9,15,17,19,21-decaene |
| SMILES | CCCCc1ccc2cc3c(cc2c1)-c1ccc2ccccc2[n+]1C(C)(OC(C=C(OC)C(F)(F)F)C(F)(F)F)C3(CC)CC |
| InChI | InChI=1S/C36H38F6NO2/c1-6-9-12-23-15-16-25-21-28-27(20-26(25)19-23)30-18-17-24-13-10-11-14-29(24)43(30)33(4,34(28,7-2)8-3)45-32(36(40,41)42)22-31(44-5)35(37,38)39/h10-11,13-22,32H,6-9,12H2,1-5H3/q+1 |
| InChIKey | FEJBGQVVMSHGRR-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.69 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|