C44H48Cl2N4O8 — CID 123960195
(2-benzoyloxy-4,5-diethyl-4-methyloxolan-3-yl) benzoate;[2-(2,6-dichloropurin-9-yl)-4,5-diethyl-4-methyloxolan-3-yl] benzoate (PubChem CID 123960195) has the molecular formula C44H48Cl2N4O8 and a molecular weight of 831.79 g/mol. Its IUPAC name is (2-benzoyloxy-4,5-diethyl-4-methyloxolan-3-yl) benzoate;[2-(2,6-dichloropurin-9-yl)-4,5-diethyl-4-methyloxolan-3-yl] benzoate.
| Compound Name | (2-benzoyloxy-4,5-diethyl-4-methyloxolan-3-yl) benzoate;[2-(2,6-dichloropurin-9-yl)-4,5-diethyl-4-methyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 123960195 |
| Molecular Formula | C44H48Cl2N4O8 |
| Molecular Weight | 831.79 g/mol |
| Exact Mass | 830.28 |
| IUPAC Name | (2-benzoyloxy-4,5-diethyl-4-methyloxolan-3-yl) benzoate;[2-(2,6-dichloropurin-9-yl)-4,5-diethyl-4-methyloxolan-3-yl] benzoate |
| SMILES | CCC1OC(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1(C)CC.CCC1OC(n2cnc3c(Cl)nc(Cl)nc32)C(OC(=O)c2ccccc2)C1(C)CC |
| InChI | InChI=1S/C23H26O5.C21H22Cl2N4O3/c1-4-18-23(3,5-2)19(27-20(24)16-12-8-6-9-13-16)22(26-18)28-21(25)17-14-10-7-11-15-17;1-4-13-21(3,5-2)15(30-19(28)12-9-7-6-8-10-12)18(29-13)27-11-24-14-16(22)25-20(23)26-17(14)27/h6-15,18-19,22H,4-5H2,1-3H3;6-11,13,15,18H,4-5H2,1-3H3 |
| InChIKey | GGEXXQXHAAWNEP-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 140.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.79 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|