C39H25ClF10O — CID 123963276
1-chloro-5-[[2,6-difluoro-4-(4-octa-3,7-dienylphenyl)phenoxy]-difluoromethyl]-2-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorobenzene (PubChem CID 123963276) has the molecular formula C39H25ClF10O and a molecular weight of 735.06 g/mol. Its IUPAC name is 1-chloro-5-[[2,6-difluoro-4-(4-octa-3,7-dienylphenyl)phenoxy]-difluoromethyl]-2-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorobenzene.
| Compound Name | 1-chloro-5-[[2,6-difluoro-4-(4-octa-3,7-dienylphenyl)phenoxy]-difluoromethyl]-2-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorobenzene |
|---|---|
| PubChem CID | 123963276 |
| Molecular Formula | C39H25ClF10O |
| Molecular Weight | 735.06 g/mol |
| Exact Mass | 734.14 |
| IUPAC Name | 1-chloro-5-[[2,6-difluoro-4-(4-octa-3,7-dienylphenyl)phenoxy]-difluoromethyl]-2-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-3-fluorobenzene |
| SMILES | C=CCCC=CCCc1ccc(-c2cc(F)c(OC(F)(F)c3cc(F)c(-c4cc(F)c(-c5cc(F)c(F)c(F)c5)c(F)c4)c(Cl)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C39H25ClF10O/c1-2-3-4-5-6-7-8-21-9-11-22(12-10-21)23-13-33(46)38(34(47)14-23)51-39(49,50)26-19-27(40)35(30(43)20-26)24-15-28(41)36(29(42)16-24)25-17-31(44)37(48)32(45)18-25/h2,5-6,9-20H,1,3-4,7-8H2 |
| InChIKey | RLQYLGTVLFAWFM-UHFFFAOYSA-N |
| XLogP | 13.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.06 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|